C11H5Br3ClFS — CID 107991759
2,5-dibromo-3-[bromo-(4-chloro-3-fluorophenyl)methyl]thiophene (PubChem CID 107991759) has the molecular formula C11H5Br3ClFS and a molecular weight of 463.39 g/mol. Its IUPAC name is 2,5-dibromo-3-[bromo-(4-chloro-3-fluorophenyl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[bromo-(4-chloro-3-fluorophenyl)methyl]thiophene |
|---|---|
| PubChem CID | 107991759 |
| Molecular Formula | C11H5Br3ClFS |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 459.73 |
| IUPAC Name | 2,5-dibromo-3-[bromo-(4-chloro-3-fluorophenyl)methyl]thiophene |
| SMILES | Fc1cc(C(Br)c2cc(Br)sc2Br)ccc1Cl |
| InChI | InChI=1S/C11H5Br3ClFS/c12-9-4-6(11(14)17-9)10(13)5-1-2-7(15)8(16)3-5/h1-4,10H |
| InChIKey | KELGIFYYWLCYLW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|