C12H9Br2FO2S — CID 114022284
(2,5-dibromothiophen-3-yl)-(2-fluoro-3-methoxyphenyl)methanol (PubChem CID 114022284) has the molecular formula C12H9Br2FO2S and a molecular weight of 396.08 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(2-fluoro-3-methoxyphenyl)methanol.
| Compound Name | (2,5-dibromothiophen-3-yl)-(2-fluoro-3-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 114022284 |
| Molecular Formula | C12H9Br2FO2S |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(2-fluoro-3-methoxyphenyl)methanol |
| SMILES | COc1cccc(C(O)c2cc(Br)sc2Br)c1F |
| InChI | InChI=1S/C12H9Br2FO2S/c1-17-8-4-2-3-6(10(8)15)11(16)7-5-9(13)18-12(7)14/h2-5,11,16H,1H3 |
| InChIKey | YIFPNUAZQBIHSA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |