C14H8BrClF4O — CID 107477463
1-[bromo-[2-(difluoromethoxy)phenyl]methyl]-2-chloro-4,5-difluorobenzene (PubChem CID 107477463) has the molecular formula C14H8BrClF4O and a molecular weight of 383.57 g/mol. Its IUPAC name is 1-[bromo-[2-(difluoromethoxy)phenyl]methyl]-2-chloro-4,5-difluorobenzene.
| Compound Name | 1-[bromo-[2-(difluoromethoxy)phenyl]methyl]-2-chloro-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477463 |
| Molecular Formula | C14H8BrClF4O |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | 1-[bromo-[2-(difluoromethoxy)phenyl]methyl]-2-chloro-4,5-difluorobenzene |
| SMILES | Fc1cc(Cl)c(C(Br)c2ccccc2OC(F)F)cc1F |
| InChI | InChI=1S/C14H8BrClF4O/c15-13(8-5-10(17)11(18)6-9(8)16)7-3-1-2-4-12(7)21-14(19)20/h1-6,13-14H |
| InChIKey | PCRPMTYIJJVSBI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|