C14H8ClF5O — CID 63430465
2-[chloro-[2-(difluoromethoxy)phenyl]methyl]-1,3,5-trifluorobenzene (PubChem CID 63430465) has the molecular formula C14H8ClF5O and a molecular weight of 322.66 g/mol. Its IUPAC name is 2-[chloro-[2-(difluoromethoxy)phenyl]methyl]-1,3,5-trifluorobenzene.
| Compound Name | 2-[chloro-[2-(difluoromethoxy)phenyl]methyl]-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 63430465 |
| Molecular Formula | C14H8ClF5O |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 2-[chloro-[2-(difluoromethoxy)phenyl]methyl]-1,3,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Cl)c2ccccc2OC(F)F)c(F)c1 |
| InChI | InChI=1S/C14H8ClF5O/c15-13(12-9(17)5-7(16)6-10(12)18)8-3-1-2-4-11(8)21-14(19)20/h1-6,13-14H |
| InChIKey | BULPAGIRQXFTAG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|