C15H9ClF2OS — CID 107477095
1-benzothiophen-2-yl-(2-chloro-4,5-difluorophenyl)methanol (PubChem CID 107477095) has the molecular formula C15H9ClF2OS and a molecular weight of 310.75 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-(2-chloro-4,5-difluorophenyl)methanol.
| Compound Name | 1-benzothiophen-2-yl-(2-chloro-4,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 107477095 |
| Molecular Formula | C15H9ClF2OS |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 1-benzothiophen-2-yl-(2-chloro-4,5-difluorophenyl)methanol |
| SMILES | OC(c1cc2ccccc2s1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H9ClF2OS/c16-10-7-12(18)11(17)6-9(10)15(19)14-5-8-3-1-2-4-13(8)20-14/h1-7,15,19H |
| InChIKey | ZMYUOWRQMCJMEO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|