C14H23NO4S — CID 64674550
2-butylsulfonyl-1-(2,5-dimethoxyphenyl)ethanamine (PubChem CID 64674550) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-butylsulfonyl-1-(2,5-dimethoxyphenyl)ethanamine.
| Compound Name | 2-butylsulfonyl-1-(2,5-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 64674550 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-butylsulfonyl-1-(2,5-dimethoxyphenyl)ethanamine |
| SMILES | CCCCS(=O)(=O)CC(N)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H23NO4S/c1-4-5-8-20(16,17)10-13(15)12-9-11(18-2)6-7-14(12)19-3/h6-7,9,13H,4-5,8,10,15H2,1-3H3 |
| InChIKey | BVZPVDWDECDVFA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |