C17H25ClN2O3 — CID 171298619
6-chloro-3-methoxy-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol (PubChem CID 171298619) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 6-chloro-3-methoxy-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol.
| Compound Name | 6-chloro-3-methoxy-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 171298619 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 6-chloro-3-methoxy-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol |
| SMILES | COc1ccc(Cl)c(O)c1[C@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H25ClN2O3/c1-22-14-3-2-13(18)17(21)15(14)16(12-4-10-23-11-5-12)20-8-6-19-7-9-20/h2-3,12,16,19,21H,4-11H2,1H3/t16-/m0/s1 |
| InChIKey | RBEGODUAZDAIOB-INIZCTEOSA-N |
| XLogP | 2.43 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|