C18H27Cl2N3O3 — CID 171301619
3-hydroxy-4-methoxy-2-[(R)-oxan-4-yl(piperazin-1-yl)methyl]benzonitrile;dihydrochloride (PubChem CID 171301619) has the molecular formula C18H27Cl2N3O3 and a molecular weight of 404.34 g/mol. Its IUPAC name is 3-hydroxy-4-methoxy-2-[(R)-oxan-4-yl(piperazin-1-yl)methyl]benzonitrile;dihydrochloride.
| Compound Name | 3-hydroxy-4-methoxy-2-[(R)-oxan-4-yl(piperazin-1-yl)methyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171301619 |
| Molecular Formula | C18H27Cl2N3O3 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-hydroxy-4-methoxy-2-[(R)-oxan-4-yl(piperazin-1-yl)methyl]benzonitrile;dihydrochloride |
| SMILES | COc1ccc(C#N)c([C@@H](C2CCOCC2)N2CCNCC2)c1O.Cl.Cl |
| InChI | InChI=1S/C18H25N3O3.2ClH/c1-23-15-3-2-14(12-19)16(18(15)22)17(13-4-10-24-11-5-13)21-8-6-20-7-9-21;;/h2-3,13,17,20,22H,4-11H2,1H3;2*1H/t17-;;/m1../s1 |
| InChIKey | WVEZVKYQXBTXNG-ZEECNFPPSA-N |
| XLogP | 2.49 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|