C17H25Cl2N3O2 — CID 171299145
2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-3-hydroxy-4-methoxybenzonitrile;dihydrochloride (PubChem CID 171299145) has the molecular formula C17H25Cl2N3O2 and a molecular weight of 374.31 g/mol. Its IUPAC name is 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-3-hydroxy-4-methoxybenzonitrile;dihydrochloride.
| Compound Name | 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-3-hydroxy-4-methoxybenzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171299145 |
| Molecular Formula | C17H25Cl2N3O2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-3-hydroxy-4-methoxybenzonitrile;dihydrochloride |
| SMILES | COc1ccc(C#N)c([C@H](CC2CC2)N2CCNCC2)c1O.Cl.Cl |
| InChI | InChI=1S/C17H23N3O2.2ClH/c1-22-15-5-4-13(11-18)16(17(15)21)14(10-12-2-3-12)20-8-6-19-7-9-20;;/h4-5,12,14,19,21H,2-3,6-10H2,1H3;2*1H/t14-;;/m0../s1 |
| InChIKey | NVPKWTXNOVPKIQ-UTLKBRERSA-N |
| XLogP | 2.86 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|