C16H22Cl2FN3O — CID 171298586
2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-4-fluoro-3-hydroxybenzonitrile;dihydrochloride (PubChem CID 171298586) has the molecular formula C16H22Cl2FN3O and a molecular weight of 362.28 g/mol. Its IUPAC name is 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-4-fluoro-3-hydroxybenzonitrile;dihydrochloride.
| Compound Name | 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-4-fluoro-3-hydroxybenzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171298586 |
| Molecular Formula | C16H22Cl2FN3O |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[(1S)-2-cyclopropyl-1-piperazin-1-ylethyl]-4-fluoro-3-hydroxybenzonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1ccc(F)c(O)c1[C@H](CC1CC1)N1CCNCC1 |
| InChI | InChI=1S/C16H20FN3O.2ClH/c17-13-4-3-12(10-18)15(16(13)21)14(9-11-1-2-11)20-7-5-19-6-8-20;;/h3-4,11,14,19,21H,1-2,5-9H2;2*1H/t14-;;/m0../s1 |
| InChIKey | XYTNMVDRAMZDFV-UTLKBRERSA-N |
| XLogP | 2.99 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|