C18H29BrCl2N2O2 — CID 171278487
1-[(S)-(5-bromo-2-ethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171278487) has the molecular formula C18H29BrCl2N2O2 and a molecular weight of 456.25 g/mol. Its IUPAC name is 1-[(S)-(5-bromo-2-ethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(5-bromo-2-ethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171278487 |
| Molecular Formula | C18H29BrCl2N2O2 |
| Molecular Weight | 456.25 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 1-[(S)-(5-bromo-2-ethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | CCOc1ccc(Br)cc1[C@H](C1CCOCC1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H27BrN2O2.2ClH/c1-2-23-17-4-3-15(19)13-16(17)18(14-5-11-22-12-6-14)21-9-7-20-8-10-21;;/h3-4,13-14,18,20H,2,5-12H2,1H3;2*1H/t18-;;/m0../s1 |
| InChIKey | XOSIJPZAOLSNTP-NTEVMMBTSA-N |
| XLogP | 4.06 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |