C18H30Cl2N2O3 — CID 171284023
2-ethoxy-6-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol;dihydrochloride (PubChem CID 171284023) has the molecular formula C18H30Cl2N2O3 and a molecular weight of 393.36 g/mol. Its IUPAC name is 2-ethoxy-6-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol;dihydrochloride.
| Compound Name | 2-ethoxy-6-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171284023 |
| Molecular Formula | C18H30Cl2N2O3 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-ethoxy-6-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol;dihydrochloride |
| SMILES | CCOc1cccc([C@H](C2CCOCC2)N2CCNCC2)c1O.Cl.Cl |
| InChI | InChI=1S/C18H28N2O3.2ClH/c1-2-23-16-5-3-4-15(18(16)21)17(14-6-12-22-13-7-14)20-10-8-19-9-11-20;;/h3-5,14,17,19,21H,2,6-13H2,1H3;2*1H/t17-;;/m0../s1 |
| InChIKey | BOSBWXXBWAFUMP-RMRYJAPISA-N |
| XLogP | 3.01 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|