C14H18F2N2O3 — CID 171282782
[4-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-2-hydroxyphenyl] acetate (PubChem CID 171282782) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is [4-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-2-hydroxyphenyl] acetate.
| Compound Name | [4-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-2-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 171282782 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [4-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-2-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc([C@H](C(F)F)N2CCNCC2)cc1O |
| InChI | InChI=1S/C14H18F2N2O3/c1-9(19)21-12-3-2-10(8-11(12)20)13(14(15)16)18-6-4-17-5-7-18/h2-3,8,13-14,17,20H,4-7H2,1H3/t13-/m1/s1 |
| InChIKey | MGRWNYMCDHAGFY-CYBMUJFWSA-N |
| XLogP | 1.53 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|