C17H28Cl2N2O3 — CID 171282809
[4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-hydroxyphenyl] acetate;dihydrochloride (PubChem CID 171282809) has the molecular formula C17H28Cl2N2O3 and a molecular weight of 379.33 g/mol. Its IUPAC name is [4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-hydroxyphenyl] acetate;dihydrochloride.
| Compound Name | [4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-hydroxyphenyl] acetate;dihydrochloride |
|---|---|
| PubChem CID | 171282809 |
| Molecular Formula | C17H28Cl2N2O3 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [4-[(1S)-2,2-dimethyl-1-piperazin-1-ylpropyl]-2-hydroxyphenyl] acetate;dihydrochloride |
| SMILES | CC(=O)Oc1ccc([C@@H](N2CCNCC2)C(C)(C)C)cc1O.Cl.Cl |
| InChI | InChI=1S/C17H26N2O3.2ClH/c1-12(20)22-15-6-5-13(11-14(15)21)16(17(2,3)4)19-9-7-18-8-10-19;;/h5-6,11,16,18,21H,7-10H2,1-4H3;2*1H/t16-;;/m1../s1 |
| InChIKey | IFDWTWLHDUUMRB-GGMCWBHBSA-N |
| XLogP | 3.15 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|