C13H17Cl2F5N2O — CID 171301523
2-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]-4-(trifluoromethyl)phenol;dihydrochloride (PubChem CID 171301523) has the molecular formula C13H17Cl2F5N2O and a molecular weight of 383.19 g/mol. Its IUPAC name is 2-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]-4-(trifluoromethyl)phenol;dihydrochloride.
| Compound Name | 2-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]-4-(trifluoromethyl)phenol;dihydrochloride |
|---|---|
| PubChem CID | 171301523 |
| Molecular Formula | C13H17Cl2F5N2O |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2-[(1S)-2,2-difluoro-1-piperazin-1-ylethyl]-4-(trifluoromethyl)phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccc(C(F)(F)F)cc1[C@@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H15F5N2O.2ClH/c14-12(15)11(20-5-3-19-4-6-20)9-7-8(13(16,17)18)1-2-10(9)21;;/h1-2,7,11-12,19,21H,3-6H2;2*1H/t11-;;/m0../s1 |
| InChIKey | FCFHLYXOUCJFLM-IDMXKUIJSA-N |
| XLogP | 3.47 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|