C13H16Cl2F6N2O — CID 171299483
2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-fluoro-3-(trifluoromethyl)phenol;dihydrochloride (PubChem CID 171299483) has the molecular formula C13H16Cl2F6N2O and a molecular weight of 401.18 g/mol. Its IUPAC name is 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-fluoro-3-(trifluoromethyl)phenol;dihydrochloride.
| Compound Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-fluoro-3-(trifluoromethyl)phenol;dihydrochloride |
|---|---|
| PubChem CID | 171299483 |
| Molecular Formula | C13H16Cl2F6N2O |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-[(1R)-2,2-difluoro-1-piperazin-1-ylethyl]-6-fluoro-3-(trifluoromethyl)phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1c(F)ccc(C(F)(F)F)c1[C@H](C(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H14F6N2O.2ClH/c14-8-2-1-7(13(17,18)19)9(11(8)22)10(12(15)16)21-5-3-20-4-6-21;;/h1-2,10,12,20,22H,3-6H2;2*1H/t10-;;/m1../s1 |
| InChIKey | XDJXRPKTQGFOFF-YQFADDPSSA-N |
| XLogP | 3.61 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|