C14H19Cl2F3N2 — CID 171290613
1-[(R)-cyclopropyl-(2,3,4-trifluorophenyl)methyl]piperazine;dihydrochloride (PubChem CID 171290613) has the molecular formula C14H19Cl2F3N2 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1-[(R)-cyclopropyl-(2,3,4-trifluorophenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-cyclopropyl-(2,3,4-trifluorophenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290613 |
| Molecular Formula | C14H19Cl2F3N2 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-[(R)-cyclopropyl-(2,3,4-trifluorophenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc([C@@H](C2CC2)N2CCNCC2)c(F)c1F |
| InChI | InChI=1S/C14H17F3N2.2ClH/c15-11-4-3-10(12(16)13(11)17)14(9-1-2-9)19-7-5-18-6-8-19;;/h3-4,9,14,18H,1-2,5-8H2;2*1H/t14-;;/m1../s1 |
| InChIKey | GHKDFEJQYFSKSQ-FMOMHUKBSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|