C24H44Cl2N2O — CID 171307577
2,4-ditert-butyl-6-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride (PubChem CID 171307577) has the molecular formula C24H44Cl2N2O and a molecular weight of 447.54 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride.
| Compound Name | 2,4-ditert-butyl-6-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171307577 |
| Molecular Formula | C24H44Cl2N2O |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 2,4-ditert-butyl-6-[(1R)-1-piperazin-1-ylhexyl]phenol;dihydrochloride |
| SMILES | CCCCC[C@H](c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C24H42N2O.2ClH/c1-8-9-10-11-21(26-14-12-25-13-15-26)19-16-18(23(2,3)4)17-20(22(19)27)24(5,6)7;;/h16-17,21,25,27H,8-15H2,1-7H3;2*1H/t21-;;/m1../s1 |
| InChIKey | XPTFAZHRAYGJNB-GHVWMZMZSA-N |
| XLogP | 6.36 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|