C13H16ClNO2 — CID 63655288
1-(3-chloro-4,5-dimethoxyphenyl)pent-4-yn-1-amine (PubChem CID 63655288) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 1-(3-chloro-4,5-dimethoxyphenyl)pent-4-yn-1-amine.
| Compound Name | 1-(3-chloro-4,5-dimethoxyphenyl)pent-4-yn-1-amine |
|---|---|
| PubChem CID | 63655288 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-(3-chloro-4,5-dimethoxyphenyl)pent-4-yn-1-amine |
| SMILES | C#CCCC(N)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H16ClNO2/c1-4-5-6-11(15)9-7-10(14)13(17-3)12(8-9)16-2/h1,7-8,11H,5-6,15H2,2-3H3 |
| InChIKey | BYWFCSLRFNEFTI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|