C17H20ClNO2 — CID 62542898
(3-chloro-4,5-dimethoxyphenyl)-(4-ethylphenyl)methanamine (PubChem CID 62542898) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is (3-chloro-4,5-dimethoxyphenyl)-(4-ethylphenyl)methanamine.
| Compound Name | (3-chloro-4,5-dimethoxyphenyl)-(4-ethylphenyl)methanamine |
|---|---|
| PubChem CID | 62542898 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (3-chloro-4,5-dimethoxyphenyl)-(4-ethylphenyl)methanamine |
| SMILES | CCc1ccc(C(N)c2cc(Cl)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H20ClNO2/c1-4-11-5-7-12(8-6-11)16(19)13-9-14(18)17(21-3)15(10-13)20-2/h5-10,16H,4,19H2,1-3H3 |
| InChIKey | CBQZWIWCZWMYQB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |