C11H15ClO3 — CID 83950515
2-chloro-4-(1-hydroxybutyl)-6-methoxyphenol (PubChem CID 83950515) has the molecular formula C11H15ClO3 and a molecular weight of 230.69 g/mol. Its IUPAC name is 2-chloro-4-(1-hydroxybutyl)-6-methoxyphenol.
| Compound Name | 2-chloro-4-(1-hydroxybutyl)-6-methoxyphenol |
|---|---|
| PubChem CID | 83950515 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-chloro-4-(1-hydroxybutyl)-6-methoxyphenol |
| SMILES | CCCC(O)c1cc(Cl)c(O)c(OC)c1 |
| InChI | InChI=1S/C11H15ClO3/c1-3-4-9(13)7-5-8(12)11(14)10(6-7)15-2/h5-6,9,13-14H,3-4H2,1-2H3 |
| InChIKey | KWQFXEPIUDCSLN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |