C12H17Cl2NO2 — CID 171235008
4-[(1S)-1-aminopent-4-enyl]-2-chloro-6-methoxyphenol;hydrochloride (PubChem CID 171235008) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 4-[(1S)-1-aminopent-4-enyl]-2-chloro-6-methoxyphenol;hydrochloride.
| Compound Name | 4-[(1S)-1-aminopent-4-enyl]-2-chloro-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171235008 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 4-[(1S)-1-aminopent-4-enyl]-2-chloro-6-methoxyphenol;hydrochloride |
| SMILES | C=CCC[C@H](N)c1cc(Cl)c(O)c(OC)c1.Cl |
| InChI | InChI=1S/C12H16ClNO2.ClH/c1-3-4-5-10(14)8-6-9(13)12(15)11(7-8)16-2;/h3,6-7,10,15H,1,4-5,14H2,2H3;1H/t10-;/m0./s1 |
| InChIKey | PDVPVFVVTFWXRR-PPHPATTJSA-N |
| XLogP | 3.44 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|