About CID 158374433
CID 158374433 (PubChem CID 158374433) has the molecular formula C26H27B2Br2O4
and a molecular weight of 584.93 g/mol.
Molecular Properties
| Compound Name | CID 158374433 |
| PubChem CID | 158374433 |
| Molecular Formula | C26H27B2Br2O4 |
| Molecular Weight | 584.93 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | — |
| SMILES | Brc1ccc(-c2ccc(Br)cc2)cc1.C.C.O[B]Oc1ccc(-c2ccc(B(O)O)cc2)cc1 |
| InChI | InChI=1S/C12H11B2O4.C12H8Br2.2CH4/c15-13-18-12-7-3-10(4-8-12)9-1-5-11(6-2-9)14(16)17;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;;/h1-8,15-17H;1-8H;2*1H4 |
| InChIKey | TZYYAUTXRQIYOR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.93 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158374433 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158374433?
The IUPAC name of CID 158374433 (CID 158374433) is not available.
What is the SMILES notation for CID 158374433?
The canonical SMILES for CID 158374433 is Brc1ccc(-c2ccc(Br)cc2)cc1.C.C.O[B]Oc1ccc(-c2ccc(B(O)O)cc2)cc1.
What is the InChIKey of CID 158374433?
The InChIKey is TZYYAUTXRQIYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11B2O4.C12H8Br2.2CH4/c15-13-18-12-7-3-10(4-8-12)9-1-5-11(6-2-9)14(16)17;13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;;/h1-8,15-17H;1-8H;2*1H4.
What are the key properties of CID 158374433?
CID 158374433 has a molecular weight of 584.93 g/mol, XLogP of 6.09, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158374433 is sourced from PubChem (CID 158374433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).