About CID 158785792
CID 158785792 (PubChem CID 158785792) has the molecular formula C36H27BBr2IO2
and a molecular weight of 789.13 g/mol.
Molecular Properties
| Compound Name | CID 158785792 |
| PubChem CID | 158785792 |
| Molecular Formula | C36H27BBr2IO2 |
| Molecular Weight | 789.13 g/mol |
| Exact Mass | 786.95 |
| IUPAC Name | — |
| SMILES | Brc1ccc(-c2cccc(-c3ccccc3)c2)cc1.Brc1ccc(I)cc1.O[B]Oc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H13Br.C12H10BO2.C6H4BrI/c19-18-11-9-15(10-12-18)17-8-4-7-16(13-17)14-5-2-1-3-6-14;14-13-15-12-8-4-7-11(9-12)10-5-2-1-3-6-10;7-5-1-3-6(8)4-2-5/h1-13H;1-9,14H;1-4H |
| InChIKey | NHCLBXPMIRKWHM-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 789.13 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 158785792 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158785792?
The IUPAC name of CID 158785792 (CID 158785792) is not available.
What is the SMILES notation for CID 158785792?
The canonical SMILES for CID 158785792 is Brc1ccc(-c2cccc(-c3ccccc3)c2)cc1.Brc1ccc(I)cc1.O[B]Oc1cccc(-c2ccccc2)c1.
What is the InChIKey of CID 158785792?
The InChIKey is NHCLBXPMIRKWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Br.C12H10BO2.C6H4BrI/c19-18-11-9-15(10-12-18)17-8-4-7-16(13-17)14-5-2-1-3-6-14;14-13-15-12-8-4-7-11(9-12)10-5-2-1-3-6-10;7-5-1-3-6(8)4-2-5/h1-13H;1-9,14H;1-4H.
What are the key properties of CID 158785792?
CID 158785792 has a molecular weight of 789.13 g/mol, XLogP of 11.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158785792 is sourced from PubChem (CID 158785792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).