About 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene
1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene (PubChem CID 162245084) has the molecular formula C24H17Br2I
and a molecular weight of 592.11 g/mol. Its IUPAC name is 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene |
| PubChem CID | 162245084 |
| Molecular Formula | C24H17Br2I |
| Molecular Weight | 592.11 g/mol |
| Exact Mass | 589.87 |
| IUPAC Name | 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene |
| SMILES | Brc1ccc(-c2ccc(I)cc2)cc1.Brc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H8BrI.C12H9Br/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-8H;1-9H |
| InChIKey | ZXFMSIXMIYZVSC-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.11 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene?
The IUPAC name of 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene (CID 162245084) is 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene.
What is the SMILES notation for 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene?
The canonical SMILES for 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene is Brc1ccc(-c2ccc(I)cc2)cc1.Brc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene?
The InChIKey is ZXFMSIXMIYZVSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrI.C12H9Br/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-8H;1-9H.
What are the key properties of 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene?
1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene has a molecular weight of 592.11 g/mol, XLogP of 8.84, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-(4-iodophenyl)benzene;1-bromo-4-phenylbenzene is sourced from PubChem (CID 162245084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).