C23H17BNO2 — CID 160726204
CID 160726204 (PubChem CID 160726204) has the molecular formula C23H17BNO2 and a molecular weight of 350.21 g/mol.
| Compound Name | CID 160726204 |
|---|---|
| PubChem CID | 160726204 |
| Molecular Formula | C23H17BNO2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | — |
| SMILES | O[B]Oc1cccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H17BNO2/c26-24-27-21-13-7-12-19(14-21)23-16-20(17-8-3-1-4-9-17)15-22(25-23)18-10-5-2-6-11-18/h1-16,26H |
| InChIKey | QWOXMQVBCUFMEC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|