About CID 123337732
CID 123337732 (PubChem CID 123337732) has the molecular formula C14H14BO2
and a molecular weight of 225.08 g/mol.
Molecular Properties
| Compound Name | CID 123337732 |
| PubChem CID | 123337732 |
| Molecular Formula | C14H14BO2 |
| Molecular Weight | 225.08 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | — |
| SMILES | CCc1ccc(-c2ccc(O[B]O)cc2)cc1 |
| InChI | InChI=1S/C14H14BO2/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)17-15-16/h3-10,16H,2H2,1H3 |
| InChIKey | QLTXICWTGCPWGG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.08 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123337732 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123337732?
The IUPAC name of CID 123337732 (CID 123337732) is not available.
What is the SMILES notation for CID 123337732?
The canonical SMILES for CID 123337732 is CCc1ccc(-c2ccc(O[B]O)cc2)cc1.
What is the InChIKey of CID 123337732?
The InChIKey is QLTXICWTGCPWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BO2/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)17-15-16/h3-10,16H,2H2,1H3.
What are the key properties of CID 123337732?
CID 123337732 has a molecular weight of 225.08 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123337732 is sourced from PubChem (CID 123337732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).