About CID 162027141
CID 162027141 (PubChem CID 162027141) has the molecular formula C9H14BN2O2
and a molecular weight of 193.04 g/mol.
Molecular Properties
| Compound Name | CID 162027141 |
| PubChem CID | 162027141 |
| Molecular Formula | C9H14BN2O2 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | — |
| SMILES | NCC(N)Cc1ccc(O[B]O)cc1 |
| InChI | InChI=1S/C9H14BN2O2/c11-6-8(12)5-7-1-3-9(4-2-7)14-10-13/h1-4,8,13H,5-6,11-12H2 |
| InChIKey | MMGOEOBACDZHPY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162027141 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162027141?
The IUPAC name of CID 162027141 (CID 162027141) is not available.
What is the SMILES notation for CID 162027141?
The canonical SMILES for CID 162027141 is NCC(N)Cc1ccc(O[B]O)cc1.
What is the InChIKey of CID 162027141?
The InChIKey is MMGOEOBACDZHPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BN2O2/c11-6-8(12)5-7-1-3-9(4-2-7)14-10-13/h1-4,8,13H,5-6,11-12H2.
What are the key properties of CID 162027141?
CID 162027141 has a molecular weight of 193.04 g/mol, XLogP of -0.58, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162027141 is sourced from PubChem (CID 162027141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).