C13H16N2 — CID 68655255
(2S)-3-naphthalen-2-ylpropane-1,2-diamine (PubChem CID 68655255) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is (2S)-3-naphthalen-2-ylpropane-1,2-diamine.
| Compound Name | (2S)-3-naphthalen-2-ylpropane-1,2-diamine |
|---|---|
| PubChem CID | 68655255 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (2S)-3-naphthalen-2-ylpropane-1,2-diamine |
| SMILES | NC[C@@H](N)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H16N2/c14-9-13(15)8-10-5-6-11-3-1-2-4-12(11)7-10/h1-7,13H,8-9,14-15H2/t13-/m0/s1 |
| InChIKey | WYVUPWLUZKHJTR-ZDUSSCGKSA-N |
| XLogP | 1.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |