C28H26Cl3P — CID 19009660
(3,4-dichlorophenyl)methyl-tris(3-methylphenyl)phosphanium chloride (PubChem CID 19009660) has the molecular formula C28H26Cl3P and a molecular weight of 499.85 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl-tris(3-methylphenyl)phosphanium chloride.
| Compound Name | (3,4-dichlorophenyl)methyl-tris(3-methylphenyl)phosphanium chloride |
|---|---|
| PubChem CID | 19009660 |
| Molecular Formula | C28H26Cl3P |
| Molecular Weight | 499.85 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | (3,4-dichlorophenyl)methyl-tris(3-methylphenyl)phosphanium chloride |
| SMILES | Cc1cccc([P+](Cc2ccc(Cl)c(Cl)c2)(c2cccc(C)c2)c2cccc(C)c2)c1.[Cl-] |
| InChI | InChI=1S/C28H26Cl2P.ClH/c1-20-7-4-10-24(15-20)31(25-11-5-8-21(2)16-25,26-12-6-9-22(3)17-26)19-23-13-14-27(29)28(30)18-23;/h4-18H,19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WBXOUXKRPHBOFT-UHFFFAOYSA-M |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|