C16H15BrCl2 — CID 63438267
1-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-2,4-dimethylbenzene (PubChem CID 63438267) has the molecular formula C16H15BrCl2 and a molecular weight of 358.11 g/mol. Its IUPAC name is 1-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-2,4-dimethylbenzene.
| Compound Name | 1-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 63438267 |
| Molecular Formula | C16H15BrCl2 |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 1-[1-bromo-2-(3,4-dichlorophenyl)ethyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C(Br)Cc2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C16H15BrCl2/c1-10-3-5-13(11(2)7-10)14(17)8-12-4-6-15(18)16(19)9-12/h3-7,9,14H,8H2,1-2H3 |
| InChIKey | DHWZWTXWVHILES-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|