About acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate
acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate (PubChem CID 23192648) has the molecular formula C28H35O5P
and a molecular weight of 482.56 g/mol. Its IUPAC name is acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate.
Molecular Properties
| Compound Name | acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate |
| PubChem CID | 23192648 |
| Molecular Formula | C28H35O5P |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate |
| SMILES | CC(=O)O.CC(=O)[O-].Cc1cccc([P+](CCCO)(c2cccc(C)c2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C24H28OP.2C2H4O2/c1-19-8-4-11-22(16-19)26(15-7-14-25,23-12-5-9-20(2)17-23)24-13-6-10-21(3)18-24;2*1-2(3)4/h4-6,8-13,16-18,25H,7,14-15H2,1-3H3;2*1H3,(H,3,4)/q+1;;/p-1 |
| InChIKey | RFJSCHANGYBLLI-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate?
The IUPAC name of acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate (CID 23192648) is acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate.
What is the SMILES notation for acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate?
The canonical SMILES for acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate is CC(=O)O.CC(=O)[O-].Cc1cccc([P+](CCCO)(c2cccc(C)c2)c2cccc(C)c2)c1.
What is the InChIKey of acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate?
The InChIKey is RFJSCHANGYBLLI-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H28OP.2C2H4O2/c1-19-8-4-11-22(16-19)26(15-7-14-25,23-12-5-9-20(2)17-23)24-13-6-10-21(3)18-24;2*1-2(3)4/h4-6,8-13,16-18,25H,7,14-15H2,1-3H3;2*1H3,(H,3,4)/q+1;;/p-1.
What are the key properties of acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate?
acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate has a molecular weight of 482.56 g/mol, XLogP of 3.14, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate is sourced from PubChem (CID 23192648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).