C28H35O5P — CID 23192648
acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate (PubChem CID 23192648) has the molecular formula C28H35O5P and a molecular weight of 482.56 g/mol. Its IUPAC name is acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate.
| Compound Name | acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate |
|---|---|
| PubChem CID | 23192648 |
| Molecular Formula | C28H35O5P |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | acetic acid;3-hydroxypropyl-tris(3-methylphenyl)phosphanium;acetate |
| SMILES | CC(=O)O.CC(=O)[O-].Cc1cccc([P+](CCCO)(c2cccc(C)c2)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C24H28OP.2C2H4O2/c1-19-8-4-11-22(16-19)26(15-7-14-25,23-12-5-9-20(2)17-23)24-13-6-10-21(3)18-24;2*1-2(3)4/h4-6,8-13,16-18,25H,7,14-15H2,1-3H3;2*1H3,(H,3,4)/q+1;;/p-1 |
| InChIKey | RFJSCHANGYBLLI-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|