About 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium
3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium (PubChem CID 87593722) has the molecular formula C32H28O5PS+
and a molecular weight of 555.61 g/mol. Its IUPAC name is 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium.
Molecular Properties
| Compound Name | 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium |
| PubChem CID | 87593722 |
| Molecular Formula | C32H28O5PS+ |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium |
| SMILES | COC(=O)c1cccc(S(=O)(=O)O)c1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.C8H8O5S/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-13-8(9)6-3-2-4-7(5-6)14(10,11)12/h1-20H;2-5H,1H3,(H,10,11,12)/q+1; |
| InChIKey | MAZBWEMFCXPKGH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium?
The IUPAC name of 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium (CID 87593722) is 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium.
What is the SMILES notation for 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium?
The canonical SMILES for 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium is COC(=O)c1cccc(S(=O)(=O)O)c1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium?
The InChIKey is MAZBWEMFCXPKGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20P.C8H8O5S/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-13-8(9)6-3-2-4-7(5-6)14(10,11)12/h1-20H;2-5H,1H3,(H,10,11,12)/q+1;.
What are the key properties of 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium?
3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium has a molecular weight of 555.61 g/mol, XLogP of 5.03, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxycarbonylbenzenesulfonic acid;tetraphenylphosphanium is sourced from PubChem (CID 87593722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).