C12H13NaO9S — CID 156852113
sodium 3-[2-(2-hydroxyethoxy)ethoxycarbonyl]-2-sulfobenzoate (PubChem CID 156852113) has the molecular formula C12H13NaO9S and a molecular weight of 356.28 g/mol. Its IUPAC name is sodium 3-[2-(2-hydroxyethoxy)ethoxycarbonyl]-2-sulfobenzoate.
| Compound Name | sodium 3-[2-(2-hydroxyethoxy)ethoxycarbonyl]-2-sulfobenzoate |
|---|---|
| PubChem CID | 156852113 |
| Molecular Formula | C12H13NaO9S |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | sodium 3-[2-(2-hydroxyethoxy)ethoxycarbonyl]-2-sulfobenzoate |
| SMILES | O=C([O-])c1cccc(C(=O)OCCOCCO)c1S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C12H14O9S.Na/c13-4-5-20-6-7-21-12(16)9-3-1-2-8(11(14)15)10(9)22(17,18)19;/h1-3,13H,4-7H2,(H,14,15)(H,17,18,19);/q;+1/p-1 |
| InChIKey | PHDYKHAJOAITHX-UHFFFAOYSA-M |
| XLogP | -4.53 |
| TPSA | 150.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|