C12H16O7P2S — CID 139815429
2,6-bis(dimethylphosphanyloxycarbonyl)benzenesulfonic acid (PubChem CID 139815429) has the molecular formula C12H16O7P2S and a molecular weight of 366.27 g/mol. Its IUPAC name is 2,6-bis(dimethylphosphanyloxycarbonyl)benzenesulfonic acid.
| Compound Name | 2,6-bis(dimethylphosphanyloxycarbonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 139815429 |
| Molecular Formula | C12H16O7P2S |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2,6-bis(dimethylphosphanyloxycarbonyl)benzenesulfonic acid |
| SMILES | CP(C)OC(=O)c1cccc(C(=O)OP(C)C)c1S(=O)(=O)O |
| InChI | InChI=1S/C12H16O7P2S/c1-20(2)18-11(13)8-6-5-7-9(10(8)22(15,16)17)12(14)19-21(3)4/h5-7H,1-4H3,(H,15,16,17) |
| InChIKey | BRRRPNYFTITGEL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|