C32H44O11S — CID 174390112
dioctyl benzene-1,2-dicarboxylate;2-sulfobenzene-1,3-dicarboxylic acid (PubChem CID 174390112) has the molecular formula C32H44O11S and a molecular weight of 636.76 g/mol. Its IUPAC name is dioctyl benzene-1,2-dicarboxylate;2-sulfobenzene-1,3-dicarboxylic acid.
| Compound Name | dioctyl benzene-1,2-dicarboxylate;2-sulfobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174390112 |
| Molecular Formula | C32H44O11S |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | dioctyl benzene-1,2-dicarboxylate;2-sulfobenzene-1,3-dicarboxylic acid |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC.O=C(O)c1cccc(C(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C24H38O4.C8H6O7S/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2;9-7(10)4-2-1-3-5(8(11)12)6(4)16(13,14)15/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1-3H,(H,9,10)(H,11,12)(H,13,14,15) |
| InChIKey | GQNXPNWFLPCYHU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 181.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|