C8H6O7S — CID 174553375
4-deuterio-2-sulfobenzene-1,3-dicarboxylic acid (PubChem CID 174553375) has the molecular formula C8H6O7S and a molecular weight of 247.20 g/mol. Its IUPAC name is 4-deuterio-2-sulfobenzene-1,3-dicarboxylic acid.
| Compound Name | 4-deuterio-2-sulfobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174553375 |
| Molecular Formula | C8H6O7S |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 4-deuterio-2-sulfobenzene-1,3-dicarboxylic acid |
| SMILES | [2H]c1ccc(C(=O)O)c(S(=O)(=O)O)c1C(=O)O |
| InChI | InChI=1S/C8H6O7S/c9-7(10)4-2-1-3-5(8(11)12)6(4)16(13,14)15/h1-3H,(H,9,10)(H,11,12)(H,13,14,15)/i2D |
| InChIKey | YZTJKOLMWJNVFH-VMNATFBRSA-N |
| XLogP | 0.33 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|