About benzenesulfonic acid;2-carbamoylbenzoic acid
benzenesulfonic acid;2-carbamoylbenzoic acid (PubChem CID 174555047) has the molecular formula C14H13NO6S
and a molecular weight of 323.33 g/mol. Its IUPAC name is benzenesulfonic acid;2-carbamoylbenzoic acid.
Molecular Properties
| Compound Name | benzenesulfonic acid;2-carbamoylbenzoic acid |
| PubChem CID | 174555047 |
| Molecular Formula | C14H13NO6S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | benzenesulfonic acid;2-carbamoylbenzoic acid |
| SMILES | NC(=O)c1ccccc1C(=O)O.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C8H7NO3.C6H6O3S/c9-7(10)5-3-1-2-4-6(5)8(11)12;7-10(8,9)6-4-2-1-3-5-6/h1-4H,(H2,9,10)(H,11,12);1-5H,(H,7,8,9) |
| InChIKey | WJWVAEJNSBYWKJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid;2-carbamoylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid;2-carbamoylbenzoic acid?
The IUPAC name of benzenesulfonic acid;2-carbamoylbenzoic acid (CID 174555047) is benzenesulfonic acid;2-carbamoylbenzoic acid.
What is the SMILES notation for benzenesulfonic acid;2-carbamoylbenzoic acid?
The canonical SMILES for benzenesulfonic acid;2-carbamoylbenzoic acid is NC(=O)c1ccccc1C(=O)O.O=S(=O)(O)c1ccccc1.
What is the InChIKey of benzenesulfonic acid;2-carbamoylbenzoic acid?
The InChIKey is WJWVAEJNSBYWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3.C6H6O3S/c9-7(10)5-3-1-2-4-6(5)8(11)12;7-10(8,9)6-4-2-1-3-5-6/h1-4H,(H2,9,10)(H,11,12);1-5H,(H,7,8,9).
What are the key properties of benzenesulfonic acid;2-carbamoylbenzoic acid?
benzenesulfonic acid;2-carbamoylbenzoic acid has a molecular weight of 323.33 g/mol, XLogP of 1.42, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid;2-carbamoylbenzoic acid is sourced from PubChem (CID 174555047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).