C18H18O9S2 — CID 129051103
2-ethyl-6-(3-ethyl-2-sulfobenzoyl)oxycarbonylbenzenesulfonic acid (PubChem CID 129051103) has the molecular formula C18H18O9S2 and a molecular weight of 442.47 g/mol. Its IUPAC name is 2-ethyl-6-(3-ethyl-2-sulfobenzoyl)oxycarbonylbenzenesulfonic acid.
| Compound Name | 2-ethyl-6-(3-ethyl-2-sulfobenzoyl)oxycarbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 129051103 |
| Molecular Formula | C18H18O9S2 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-ethyl-6-(3-ethyl-2-sulfobenzoyl)oxycarbonylbenzenesulfonic acid |
| SMILES | CCc1cccc(C(=O)OC(=O)c2cccc(CC)c2S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C18H18O9S2/c1-3-11-7-5-9-13(15(11)28(21,22)23)17(19)27-18(20)14-10-6-8-12(4-2)16(14)29(24,25)26/h5-10H,3-4H2,1-2H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | SNQGPEMKJZANDE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|