About propanoyloxycarbonyl 2-ethylbenzoate
propanoyloxycarbonyl 2-ethylbenzoate (PubChem CID 175104015) has the molecular formula C13H14O5
and a molecular weight of 250.25 g/mol. Its IUPAC name is propanoyloxycarbonyl 2-ethylbenzoate.
Molecular Properties
| Compound Name | propanoyloxycarbonyl 2-ethylbenzoate |
| PubChem CID | 175104015 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | propanoyloxycarbonyl 2-ethylbenzoate |
| SMILES | CCC(=O)OC(=O)OC(=O)c1ccccc1CC |
| InChI | InChI=1S/C13H14O5/c1-3-9-7-5-6-8-10(9)12(15)18-13(16)17-11(14)4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | WWYCQYWWECTPPJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanoyloxycarbonyl 2-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyloxycarbonyl 2-ethylbenzoate?
The IUPAC name of propanoyloxycarbonyl 2-ethylbenzoate (CID 175104015) is propanoyloxycarbonyl 2-ethylbenzoate.
What is the SMILES notation for propanoyloxycarbonyl 2-ethylbenzoate?
The canonical SMILES for propanoyloxycarbonyl 2-ethylbenzoate is CCC(=O)OC(=O)OC(=O)c1ccccc1CC.
What is the InChIKey of propanoyloxycarbonyl 2-ethylbenzoate?
The InChIKey is WWYCQYWWECTPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5/c1-3-9-7-5-6-8-10(9)12(15)18-13(16)17-11(14)4-2/h5-8H,3-4H2,1-2H3.
What are the key properties of propanoyloxycarbonyl 2-ethylbenzoate?
propanoyloxycarbonyl 2-ethylbenzoate has a molecular weight of 250.25 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyloxycarbonyl 2-ethylbenzoate is sourced from PubChem (CID 175104015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).