C18H20Cl2O5S — CID 145382592
3-[4-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]sulfanylphenoxy]propane-1,2-diol (PubChem CID 145382592) has the molecular formula C18H20Cl2O5S and a molecular weight of 419.33 g/mol. Its IUPAC name is 3-[4-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]sulfanylphenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]sulfanylphenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 145382592 |
| Molecular Formula | C18H20Cl2O5S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 3-[4-[3-chloro-4-(3-chloro-2-hydroxypropoxy)phenyl]sulfanylphenoxy]propane-1,2-diol |
| SMILES | OCC(O)COc1ccc(Sc2ccc(OCC(O)CCl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20Cl2O5S/c19-8-12(22)10-25-18-6-5-16(7-17(18)20)26-15-3-1-14(2-4-15)24-11-13(23)9-21/h1-7,12-13,21-23H,8-11H2 |
| InChIKey | YFJAVSSJVDEVEG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|