C16H19BrO4S — CID 143128499
(2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol (PubChem CID 143128499) has the molecular formula C16H19BrO4S and a molecular weight of 387.30 g/mol. Its IUPAC name is (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol.
| Compound Name | (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol |
|---|---|
| PubChem CID | 143128499 |
| Molecular Formula | C16H19BrO4S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol |
| SMILES | CO.OC[C@@H](O)COc1ccc(Sc2ccccc2)cc1Br |
| InChI | InChI=1S/C15H15BrO3S.CH4O/c16-14-8-13(20-12-4-2-1-3-5-12)6-7-15(14)19-10-11(18)9-17;1-2/h1-8,11,17-18H,9-10H2;2H,1H3/t11-;/m1./s1 |
| InChIKey | IBFBNAHRUZUFPN-RFVHGSKJSA-N |
| XLogP | 2.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |