About (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol
(2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol (PubChem CID 143128499) has the molecular formula C16H19BrO4S
and a molecular weight of 387.30 g/mol. Its IUPAC name is (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol.
Molecular Properties
| Compound Name | (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol |
| PubChem CID | 143128499 |
| Molecular Formula | C16H19BrO4S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol |
| SMILES | CO.OC[C@@H](O)COc1ccc(Sc2ccccc2)cc1Br |
| InChI | InChI=1S/C15H15BrO3S.CH4O/c16-14-8-13(20-12-4-2-1-3-5-12)6-7-15(14)19-10-11(18)9-17;1-2/h1-8,11,17-18H,9-10H2;2H,1H3/t11-;/m1./s1 |
| InChIKey | IBFBNAHRUZUFPN-RFVHGSKJSA-N |
| XLogP | 2.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol?
The IUPAC name of (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol (CID 143128499) is (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol.
What is the SMILES notation for (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol?
The canonical SMILES for (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol is CO.OC[C@@H](O)COc1ccc(Sc2ccccc2)cc1Br.
What is the InChIKey of (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol?
The InChIKey is IBFBNAHRUZUFPN-RFVHGSKJSA-N. The full InChI is InChI=1S/C15H15BrO3S.CH4O/c16-14-8-13(20-12-4-2-1-3-5-12)6-7-15(14)19-10-11(18)9-17;1-2/h1-8,11,17-18H,9-10H2;2H,1H3/t11-;/m1./s1.
What are the key properties of (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol?
(2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol has a molecular weight of 387.30 g/mol, XLogP of 2.94, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(2-bromo-4-phenylsulfanylphenoxy)propane-1,2-diol;methanol is sourced from PubChem (CID 143128499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).