C28H44ClN3O5 — CID 145119781
(Z)-2-amino-3-[amino-[3-[4-[2-[3-chloro-4-(2-hydroxybutoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol;ethane (PubChem CID 145119781) has the molecular formula C28H44ClN3O5 and a molecular weight of 538.13 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[3-[4-[2-[3-chloro-4-(2-hydroxybutoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol;ethane.
| Compound Name | (Z)-2-amino-3-[amino-[3-[4-[2-[3-chloro-4-(2-hydroxybutoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol;ethane |
|---|---|
| PubChem CID | 145119781 |
| Molecular Formula | C28H44ClN3O5 |
| Molecular Weight | 538.13 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | (Z)-2-amino-3-[amino-[3-[4-[2-[3-chloro-4-(2-hydroxybutoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol;ethane |
| SMILES | CC.CCC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)CN(N)/C(C)=C(\N)CO)cc2)cc1Cl |
| InChI | InChI=1S/C26H38ClN3O5.C2H6/c1-5-20(32)15-35-25-11-8-19(12-23(25)27)26(3,4)18-6-9-22(10-7-18)34-16-21(33)13-30(29)17(2)24(28)14-31;1-2/h6-12,20-21,31-33H,5,13-16,28-29H2,1-4H3;1-2H3/b24-17-; |
| InChIKey | NAVBJWXIHDRPRB-IJVOEZGUSA-N |
| XLogP | 3.94 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.13 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|