C25H36ClN3O5 — CID 166878974
(Z)-2-amino-3-[amino-[3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol (PubChem CID 166878974) has the molecular formula C25H36ClN3O5 and a molecular weight of 494.03 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol.
| Compound Name | (Z)-2-amino-3-[amino-[3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol |
|---|---|
| PubChem CID | 166878974 |
| Molecular Formula | C25H36ClN3O5 |
| Molecular Weight | 494.03 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (Z)-2-amino-3-[amino-[3-[4-[2-[4-(3-chloro-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl]amino]but-2-en-1-ol |
| SMILES | C/C(=C(/N)CO)N(N)CC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)CCl)cc2)cc1 |
| InChI | InChI=1S/C25H36ClN3O5/c1-17(24(27)14-30)29(28)13-21(32)16-34-23-10-6-19(7-11-23)25(2,3)18-4-8-22(9-5-18)33-15-20(31)12-26/h4-11,20-21,30-32H,12-16,27-28H2,1-3H3/b24-17- |
| InChIKey | HWTRLSMUXMJOKC-ULJHMMPZSA-N |
| XLogP | 2.09 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.03 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|