C14H21NO2S — CID 97245429
(2R)-1-phenoxy-3-(1,4-thiazepan-4-yl)propan-2-ol (PubChem CID 97245429) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is (2R)-1-phenoxy-3-(1,4-thiazepan-4-yl)propan-2-ol.
| Compound Name | (2R)-1-phenoxy-3-(1,4-thiazepan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 97245429 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (2R)-1-phenoxy-3-(1,4-thiazepan-4-yl)propan-2-ol |
| SMILES | O[C@@H](COc1ccccc1)CN1CCCSCC1 |
| InChI | InChI=1S/C14H21NO2S/c16-13(11-15-7-4-9-18-10-8-15)12-17-14-5-2-1-3-6-14/h1-3,5-6,13,16H,4,7-12H2/t13-/m1/s1 |
| InChIKey | DEOSBEGXFTULPH-CYBMUJFWSA-N |
| XLogP | 1.87 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |