C19H30N2O2S — CID 97280232
(2R)-1-[2-(piperidin-1-ylmethyl)phenoxy]-3-thiomorpholin-4-ylpropan-2-ol (PubChem CID 97280232) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is (2R)-1-[2-(piperidin-1-ylmethyl)phenoxy]-3-thiomorpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1-[2-(piperidin-1-ylmethyl)phenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 97280232 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (2R)-1-[2-(piperidin-1-ylmethyl)phenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
| SMILES | O[C@@H](COc1ccccc1CN1CCCCC1)CN1CCSCC1 |
| InChI | InChI=1S/C19H30N2O2S/c22-18(15-21-10-12-24-13-11-21)16-23-19-7-3-2-6-17(19)14-20-8-4-1-5-9-20/h2-3,6-7,18,22H,1,4-5,8-16H2/t18-/m1/s1 |
| InChIKey | NMJOXADRXNPOIL-GOSISDBHSA-N |
| XLogP | 2.46 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |