C20H33N3O2S — CID 51634139
(2S)-1-[2-[(2-pyrrolidin-1-ylethylamino)methyl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol (PubChem CID 51634139) has the molecular formula C20H33N3O2S and a molecular weight of 379.57 g/mol. Its IUPAC name is (2S)-1-[2-[(2-pyrrolidin-1-ylethylamino)methyl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[2-[(2-pyrrolidin-1-ylethylamino)methyl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 51634139 |
| Molecular Formula | C20H33N3O2S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (2S)-1-[2-[(2-pyrrolidin-1-ylethylamino)methyl]phenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
| SMILES | O[C@H](COc1ccccc1CNCCN1CCCC1)CN1CCSCC1 |
| InChI | InChI=1S/C20H33N3O2S/c24-19(16-23-11-13-26-14-12-23)17-25-20-6-2-1-5-18(20)15-21-7-10-22-8-3-4-9-22/h1-2,5-6,19,21,24H,3-4,7-17H2/t19-/m0/s1 |
| InChIKey | FHUXTPLFSLRESY-IBGZPJMESA-N |
| XLogP | 1.66 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|