C23H36N4O2 — CID 25485763
(2S)-1-[2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol (PubChem CID 25485763) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is (2S)-1-[2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol.
| Compound Name | (2S)-1-[2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 25485763 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (2S)-1-[2-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol |
| SMILES | Cc1cc(C)n(CCCNCc2ccccc2OC[C@@H](O)CN2CCCCC2)n1 |
| InChI | InChI=1S/C23H36N4O2/c1-19-15-20(2)27(25-19)14-8-11-24-16-21-9-4-5-10-23(21)29-18-22(28)17-26-12-6-3-7-13-26/h4-5,9-10,15,22,24,28H,3,6-8,11-14,16-18H2,1-2H3/t22-/m0/s1 |
| InChIKey | ZGXCHTBEYONSIC-QFIPXVFZSA-N |
| XLogP | 2.91 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|