C20H31N5O2 — CID 45231776
1-[2-[[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethylamino]methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol (PubChem CID 45231776) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[2-[[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethylamino]methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol.
| Compound Name | 1-[2-[[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethylamino]methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 45231776 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1-[2-[[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethylamino]methyl]phenoxy]-3-piperidin-1-ylpropan-2-ol |
| SMILES | Cc1nc(CCNCc2ccccc2OCC(O)CN2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C20H31N5O2/c1-16-22-20(24-23-16)9-10-21-13-17-7-3-4-8-19(17)27-15-18(26)14-25-11-5-2-6-12-25/h3-4,7-8,18,21,26H,2,5-6,9-15H2,1H3,(H,22,23,24) |
| InChIKey | SLKFLTBEIINPMS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|