C21H31ClN4O2 — CID 42591160
(2R)-1-(azepan-1-yl)-3-[4-chloro-2-[[2-(1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol (PubChem CID 42591160) has the molecular formula C21H31ClN4O2 and a molecular weight of 406.96 g/mol. Its IUPAC name is (2R)-1-(azepan-1-yl)-3-[4-chloro-2-[[2-(1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-(azepan-1-yl)-3-[4-chloro-2-[[2-(1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 42591160 |
| Molecular Formula | C21H31ClN4O2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (2R)-1-(azepan-1-yl)-3-[4-chloro-2-[[2-(1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol |
| SMILES | O[C@@H](COc1ccc(Cl)cc1CNCCc1cn[nH]c1)CN1CCCCCC1 |
| InChI | InChI=1S/C21H31ClN4O2/c22-19-5-6-21(18(11-19)14-23-8-7-17-12-24-25-13-17)28-16-20(27)15-26-9-3-1-2-4-10-26/h5-6,11-13,20,23,27H,1-4,7-10,14-16H2,(H,24,25)/t20-/m1/s1 |
| InChIKey | WVINUJGNNKZCQZ-HXUWFJFHSA-N |
| XLogP | 3.01 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|